Hi

Recently I transferred to ChimeraX from the old version. I found:

1. Some SMILE strings copied directly from ChemDraw cannot be recognized by ChimeraX, such as O=C1NC2=C(/C1=C3NC4=CC=CC=C4C/3=C\O)C=CC(Br)=C2
2. Correct me if I am wrong but ChimeraX seems not able to do molecule docking/ligand minimization like the old version, right?

Thank you

Joshua

Sent from Mail for Windows 10